CAS 71935-21-2 appears in our catalog under these names: 4-(9H-Carbazol-9-yl)benzoic acid, 98%, 4-(9H-Carbazol-9-yl)benzoic acid 98%, 4-(9H-carbazol-9-yl)benzoic acid, 95%, 95%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
4-carbazol-9-ylbenzoic acid (CAS 71935-21-2) is a chemical compound with the molecular formula C19H13NO2 and a molecular weight of 287.3 g/mol. IUPAC name: 4-carbazol-9-ylbenzoic acid. InChIKey: HKERYOYRJNUANF-UHFFFAOYSA-N.
| Molecular formula | C19H13NO2 |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | 4-carbazol-9-ylbenzoic acid |
| InChIKey | HKERYOYRJNUANF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)