Products 878475-29-7
CAS 878475-29-7 is the registry number for Isosalviamine A. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.
5,17-dimethyl-3,8-dioxa-10-azapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,7(11),9,13,15,17,19-nonaene (CAS 878475-29-7) is a chemical compound with the molecular formula C19H13NO2 and a molecular weight of 287.3 g/mol. IUPAC name: 5,17-dimethyl-3,8-dioxa-10-azapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,7(11),9,13,15,17,19-nonaene. InChIKey: ZBXNXVRDRXYXHY-UHFFFAOYSA-N.
| Molecular formula | C19H13NO2 |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | 5,17-dimethyl-3,8-dioxa-10-azapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,7(11),9,13,15,17,19-nonaene |
| InChIKey | ZBXNXVRDRXYXHY-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC3=C(C2=CC=C1)C4=C(C5=C3OC=C5C)OC=N4 |
Computed by PubChem (NCBI)
Synonyms:
Isosalviamine A, orb1992548