CAS 509078-07-3 is the registry number for 4,4'-(Pyridine-2,6-diyl)dibenzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[6-(4-formylphenyl)-2-pyridinyl]benzaldehyde (CAS 509078-07-3) is a chemical compound with the molecular formula C19H13NO2 and a molecular weight of 287.3 g/mol. IUPAC name: 4-[6-(4-formylphenyl)-2-pyridinyl]benzaldehyde. InChIKey: PKNUEHLZHNYACI-UHFFFAOYSA-N.
| Molecular formula | C19H13NO2 |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | 4-[6-(4-formylphenyl)-2-pyridinyl]benzaldehyde |
| InChIKey | PKNUEHLZHNYACI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C2=CC=C(C=C2)C=O)C3=CC=C(C=C3)C=O |
Computed by PubChem (NCBI)