CAS 123973-75-1 appears in our catalog under these names: 2-(2-Methyl-1H-indol-3-yl)naphthalene-1,4-dione, 97%, 2-(2-Methyl-1H-indol-3-yl)naphthalene-1,4-dione, 95%, 95%, 2-(2-Methyl-1H-indol-3-yl)naphthalene-1,4-dione, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10mg, 50mg, 100mg, 250mg, 1g, 500mg.
2-(2-methyl-1H-indol-3-yl)naphthalene-1,4-dione (CAS 123973-75-1) is a chemical compound with the molecular formula C19H13NO2 and a molecular weight of 287.3 g/mol. IUPAC name: 2-(2-methyl-1H-indol-3-yl)naphthalene-1,4-dione. InChIKey: WUJQCQKYMKWDSU-UHFFFAOYSA-N.
| Molecular formula | C19H13NO2 |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | 2-(2-methyl-1H-indol-3-yl)naphthalene-1,4-dione |
| InChIKey | WUJQCQKYMKWDSU-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1)C3=CC(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)