CAS 5768-24-1 appears in our catalog under these names: 2,6-Dibenzoylpyridine, ≥95%, ≥95%, 2,6-Dibenzoylpyridine, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g.
(6-benzoyl-2-pyridinyl)-phenylmethanone (CAS 5768-24-1) is a chemical compound with the molecular formula C19H13NO2 and a molecular weight of 287.3 g/mol. IUPAC name: (6-benzoyl-2-pyridinyl)-phenylmethanone. InChIKey: XXXPPUBHAGQUNW-UHFFFAOYSA-N.
| Molecular formula | C19H13NO2 |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | (6-benzoyl-2-pyridinyl)-phenylmethanone |
| InChIKey | XXXPPUBHAGQUNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=NC(=CC=C2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)