CAS 1152531-77-5 is the registry number for 3-(3-Cyanophenyl)-1,2-oxazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3-cyanophenyl)-1,2-oxazole-5-carboxylic acid (CAS 1152531-77-5) is a chemical compound with the molecular formula C11H6N2O3 and a molecular weight of 214.18 g/mol. IUPAC name: 3-(3-cyanophenyl)-1,2-oxazole-5-carboxylic acid. InChIKey: TZDONYAQYVKDDH-UHFFFAOYSA-N.
| Molecular formula | C11H6N2O3 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 3-(3-cyanophenyl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | TZDONYAQYVKDDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NOC(=C2)C(=O)O)C#N |
Computed by PubChem (NCBI)