Products 1152531-77-5

CAS 1152531-77-5 is the registry number for 3-(3-Cyanophenyl)-1,2-oxazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(3-cyanophenyl)-1,2-oxazole-5-carboxylic acid (CAS 1152531-77-5) is a chemical compound with the molecular formula C11H6N2O3 and a molecular weight of 214.18 g/mol. IUPAC name: 3-(3-cyanophenyl)-1,2-oxazole-5-carboxylic acid. InChIKey: TZDONYAQYVKDDH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H6N2O3
Molecular weight214.18 g/mol
IUPAC name3-(3-cyanophenyl)-1,2-oxazole-5-carboxylic acid
InChIKeyTZDONYAQYVKDDH-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C2=NOC(=C2)C(=O)O)C#N

Computed by PubChem (NCBI)