CAS 914220-32-9 appears in our catalog under these names: 5-(4-Cyanophenyl)-1,3-oxazole-4-carboxylic acid, 95%, 5-(4-Cyanophenyl)-1,3-oxazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-(4-cyanophenyl)-1,3-oxazole-4-carboxylic acid (CAS 914220-32-9) is a chemical compound with the molecular formula C11H6N2O3 and a molecular weight of 214.18 g/mol. IUPAC name: 5-(4-cyanophenyl)-1,3-oxazole-4-carboxylic acid. InChIKey: VFLFLOCQCZVXRF-UHFFFAOYSA-N.
| Molecular formula | C11H6N2O3 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 5-(4-cyanophenyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | VFLFLOCQCZVXRF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=C(N=CO2)C(=O)O |
Computed by PubChem (NCBI)