CAS 1152548-57-6 appears in our catalog under these names: 3-(tert-Butyl)-1-methyl-1H-pyrazole-4-carboxylic acid, 98%, 3-tert-Butyl-1-methyl-1H-pyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 100mg.
3-tert-butyl-1-methylpyrazole-4-carboxylic acid (CAS 1152548-57-6) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 3-tert-butyl-1-methylpyrazole-4-carboxylic acid. InChIKey: JTQODPDZPJQEKR-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 3-tert-butyl-1-methylpyrazole-4-carboxylic acid |
| InChIKey | JTQODPDZPJQEKR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C=C1C(=O)O)C |
Computed by PubChem (NCBI)