CAS 1152576-78-7 appears in our catalog under these names: Methyl 3-amino-5-(3,5-dichlorophenyl)thiophene-2-carboxylate, 95%, Methyl 3-amino-5-(3,5-dichlorophenyl)thiophene-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Methyl 3-amino-5-(3,5-dichlorophenyl)thiophene-2-carboxylate (CAS 1152576-78-7) is a chemical compound with the molecular formula C12H9Cl2NO2S and a molecular weight of 302.2 g/mol. IUPAC name: methyl 3-amino-5-(3,5-dichlorophenyl)thiophene-2-carboxylate. InChIKey: VGQDEFVTYMTIJR-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO2S |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | methyl 3-amino-5-(3,5-dichlorophenyl)thiophene-2-carboxylate |
| InChIKey | VGQDEFVTYMTIJR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(S1)C2=CC(=CC(=C2)Cl)Cl)N |
Computed by PubChem (NCBI)