CAS 1620790-05-7 is the registry number for Ethyl 2-(2,5-dichlorophenyl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(2,5-dichlorophenyl)-1,3-thiazole-4-carboxylate (CAS 1620790-05-7) is a chemical compound with the molecular formula C12H9Cl2NO2S and a molecular weight of 302.2 g/mol. IUPAC name: ethyl 2-(2,5-dichlorophenyl)-1,3-thiazole-4-carboxylate. InChIKey: OSRKUMJJJQMUEE-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO2S |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | ethyl 2-(2,5-dichlorophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | OSRKUMJJJQMUEE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)