Products 72888-20-1

CAS 72888-20-1 is the registry number for 4-(2,6-Dichloroanilino)-3-thiophenecarboxylic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-(2,6-dichloroanilino)thiophene-3-carboxylate (CAS 72888-20-1) is a chemical compound with the molecular formula C12H9Cl2NO2S and a molecular weight of 302.2 g/mol. IUPAC name: methyl 4-(2,6-dichloroanilino)thiophene-3-carboxylate. InChIKey: QSSGUHHGMRHQIB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9Cl2NO2S
Molecular weight302.2 g/mol
IUPAC namemethyl 4-(2,6-dichloroanilino)thiophene-3-carboxylate
InChIKeyQSSGUHHGMRHQIB-UHFFFAOYSA-N
SMILESCOC(=O)C1=CSC=C1NC2=C(C=CC=C2Cl)Cl

Computed by PubChem (NCBI)