CAS 72895-88-6 appears in our catalog under these names: Eltenac, Eltenac/ 98.78% (existing batch purity), Eltenac, ≥98%, ≥98%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg, 500ug, 500μg, 500 μg.
2-[4-(2,6-dichloroanilino)thiophen-3-yl]acetic acid (CAS 72895-88-6) is a chemical compound with the molecular formula C12H9Cl2NO2S and a molecular weight of 302.2 g/mol. IUPAC name: 2-[4-(2,6-dichloroanilino)thiophen-3-yl]acetic acid. InChIKey: AELILMBZWCGOSB-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO2S |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | 2-[4-(2,6-dichloroanilino)thiophen-3-yl]acetic acid |
| InChIKey | AELILMBZWCGOSB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)NC2=CSC=C2CC(=O)O)Cl |
Computed by PubChem (NCBI)