Products 1226643-83-9
CAS 1226643-83-9 is the registry number for Ethyl 4-(3,4-dichlorophenyl)-2-thiazolecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 4-(3,4-dichlorophenyl)-1,3-thiazole-2-carboxylate (CAS 1226643-83-9) is a chemical compound with the molecular formula C12H9Cl2NO2S and a molecular weight of 302.2 g/mol. IUPAC name: ethyl 4-(3,4-dichlorophenyl)-1,3-thiazole-2-carboxylate. InChIKey: ZBPLCQNDFYGOCX-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO2S |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | ethyl 4-(3,4-dichlorophenyl)-1,3-thiazole-2-carboxylate |
| InChIKey | ZBPLCQNDFYGOCX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=CS1)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)