CAS 77167-06-7 is the registry number for N-(2,6-Dichlorophenyl)benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(2,6-dichlorophenyl)benzenesulfonamide (CAS 77167-06-7) is a chemical compound with the molecular formula C12H9Cl2NO2S and a molecular weight of 302.2 g/mol. IUPAC name: N-(2,6-dichlorophenyl)benzenesulfonamide. InChIKey: CQELSZQJFRLUFQ-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO2S |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | N-(2,6-dichlorophenyl)benzenesulfonamide |
| InChIKey | CQELSZQJFRLUFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)