CAS 1153555-49-7 is the registry number for N-(2-Hydroxypropyl)-3,4-dimethylbenzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-hydroxypropyl)-3,4-dimethylbenzenesulfonamide (CAS 1153555-49-7) is a chemical compound with the molecular formula C11H17NO3S and a molecular weight of 243.32 g/mol. IUPAC name: N-(2-hydroxypropyl)-3,4-dimethylbenzenesulfonamide. InChIKey: KKQPYINRJFJDQW-UHFFFAOYSA-N.
| Molecular formula | C11H17NO3S |
|---|---|
| Molecular weight | 243.32 g/mol |
| IUPAC name | N-(2-hydroxypropyl)-3,4-dimethylbenzenesulfonamide |
| InChIKey | KKQPYINRJFJDQW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NCC(C)O)C |
Computed by PubChem (NCBI)