CAS 123091-15-6 appears in our catalog under these names: Tamoxifen Impurity 2, 2-(dimethylamino)ethyl 4-methylbenzenesulfonate. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(dimethylamino)ethyl 4-methylbenzenesulfonate (CAS 123091-15-6) is a chemical compound with the molecular formula C11H17NO3S and a molecular weight of 243.32 g/mol. IUPAC name: 2-(dimethylamino)ethyl 4-methylbenzenesulfonate. InChIKey: HWKUGMWRLGPQBP-UHFFFAOYSA-N.
| Molecular formula | C11H17NO3S |
|---|---|
| Molecular weight | 243.32 g/mol |
| IUPAC name | 2-(dimethylamino)ethyl 4-methylbenzenesulfonate |
| InChIKey | HWKUGMWRLGPQBP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCN(C)C |
Computed by PubChem (NCBI)