CAS 896743-24-1 is the registry number for (R)-2-Methylpyrrolidine benzenesulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzenesulfonic acid;(2R)-2-methylpyrrolidine (CAS 896743-24-1) is a chemical compound with the molecular formula C11H17NO3S and a molecular weight of 243.32 g/mol. IUPAC name: benzenesulfonic acid;(2R)-2-methylpyrrolidine. InChIKey: HDMLEZIULSIPQX-QDXATWJZSA-N.
| Molecular formula | C11H17NO3S |
|---|---|
| Molecular weight | 243.32 g/mol |
| IUPAC name | benzenesulfonic acid;(2R)-2-methylpyrrolidine |
| InChIKey | HDMLEZIULSIPQX-QDXATWJZSA-N |
| SMILES | C[C@@H]1CCCN1.C1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)