CAS 2719031-35-1 is the registry number for 3-Methylazetidine p-toluenesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-methylazetidine;4-methylbenzenesulfonic acid (CAS 2719031-35-1) is a chemical compound with the molecular formula C11H17NO3S and a molecular weight of 243.32 g/mol. IUPAC name: 3-methylazetidine;4-methylbenzenesulfonic acid. InChIKey: DDSASXQCYXXZDT-UHFFFAOYSA-N.
| Molecular formula | C11H17NO3S |
|---|---|
| Molecular weight | 243.32 g/mol |
| IUPAC name | 3-methylazetidine;4-methylbenzenesulfonic acid |
| InChIKey | DDSASXQCYXXZDT-UHFFFAOYSA-N |
| SMILES | CC1CNC1.CC1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)