CAS 29668-57-3 is the registry number for N-(2-Hydroxy-2-methylpropyl)-4-methylbenzenesulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
N-(2-hydroxy-2-methylpropyl)-4-methylbenzenesulfonamide (CAS 29668-57-3) is a chemical compound with the molecular formula C11H17NO3S and a molecular weight of 243.32 g/mol. IUPAC name: N-(2-hydroxy-2-methylpropyl)-4-methylbenzenesulfonamide. InChIKey: GZOFVDOIJAMYLC-UHFFFAOYSA-N.
| Molecular formula | C11H17NO3S |
|---|---|
| Molecular weight | 243.32 g/mol |
| IUPAC name | N-(2-hydroxy-2-methylpropyl)-4-methylbenzenesulfonamide |
| InChIKey | GZOFVDOIJAMYLC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NCC(C)(C)O |
Computed by PubChem (NCBI)