CAS 1241605-28-6 is the registry number for 1-(1-Ethyl-2,5-dimethyl-1H-pyrrol-3-yl)-2-(methylsulfonyl)ethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-methylsulfonylethanone (CAS 1241605-28-6) is a chemical compound with the molecular formula C11H17NO3S and a molecular weight of 243.32 g/mol. IUPAC name: 1-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-methylsulfonylethanone. InChIKey: ZVSFLPFMXBEYBX-UHFFFAOYSA-N.
| Molecular formula | C11H17NO3S |
|---|---|
| Molecular weight | 243.32 g/mol |
| IUPAC name | 1-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-methylsulfonylethanone |
| InChIKey | ZVSFLPFMXBEYBX-UHFFFAOYSA-N |
| SMILES | CCN1C(=CC(=C1C)C(=O)CS(=O)(=O)C)C |
Computed by PubChem (NCBI)