Products 1153559-74-0
CAS 1153559-74-0 is the registry number for ((3-Chloro-4-cyanophenyl)carbamoyl)formic acid. Offered by: Biosynth. Available pack sizes: 1g, 0,5g, 2g, 5g, 10g.
2-(3-chloro-4-cyanoanilino)-2-oxoacetic acid (CAS 1153559-74-0) is a chemical compound with the molecular formula C9H5ClN2O3 and a molecular weight of 224.60 g/mol. IUPAC name: 2-(3-chloro-4-cyanoanilino)-2-oxoacetic acid. InChIKey: KRCZWNYFBSUMLZ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O3 |
|---|---|
| Molecular weight | 224.60 g/mol |
| IUPAC name | 2-(3-chloro-4-cyanoanilino)-2-oxoacetic acid |
| InChIKey | KRCZWNYFBSUMLZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)C(=O)O)Cl)C#N |
Computed by PubChem (NCBI)