CAS 1153935-43-3 is the registry number for 3-((2,6-Difluorophenyl)carbamoyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(2,6-difluoroanilino)-4-oxobutanoic acid (CAS 1153935-43-3) is a chemical compound with the molecular formula C10H9F2NO3 and a molecular weight of 229.18 g/mol. IUPAC name: 4-(2,6-difluoroanilino)-4-oxobutanoic acid. InChIKey: KDCXZLAJPWEMGO-UHFFFAOYSA-N.
| Molecular formula | C10H9F2NO3 |
|---|---|
| Molecular weight | 229.18 g/mol |
| IUPAC name | 4-(2,6-difluoroanilino)-4-oxobutanoic acid |
| InChIKey | KDCXZLAJPWEMGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)NC(=O)CCC(=O)O)F |
Computed by PubChem (NCBI)