CAS 2055119-09-8 is the registry number for 2,2-Difluoro-N,N-dimethyl-1,3-benzodioxole-5-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,2-difluoro-N,N-dimethyl-1,3-benzodioxole-5-carboxamide (CAS 2055119-09-8) is a chemical compound with the molecular formula C10H9F2NO3 and a molecular weight of 229.18 g/mol. IUPAC name: 2,2-difluoro-N,N-dimethyl-1,3-benzodioxole-5-carboxamide. InChIKey: WSPDWRAMZOJYPZ-UHFFFAOYSA-N.
| Molecular formula | C10H9F2NO3 |
|---|---|
| Molecular weight | 229.18 g/mol |
| IUPAC name | 2,2-difluoro-N,N-dimethyl-1,3-benzodioxole-5-carboxamide |
| InChIKey | WSPDWRAMZOJYPZ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC2=C(C=C1)OC(O2)(F)F |
Computed by PubChem (NCBI)