CAS 197067-38-2 is the registry number for 2-(2-Acetamidophenyl)-2,2-difluoroacetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2-acetamidophenyl)-2,2-difluoroacetic acid (CAS 197067-38-2) is a chemical compound with the molecular formula C10H9F2NO3 and a molecular weight of 229.18 g/mol. IUPAC name: 2-(2-acetamidophenyl)-2,2-difluoroacetic acid. InChIKey: HPQLRFGZNVTZHW-UHFFFAOYSA-N.
| Molecular formula | C10H9F2NO3 |
|---|---|
| Molecular weight | 229.18 g/mol |
| IUPAC name | 2-(2-acetamidophenyl)-2,2-difluoroacetic acid |
| InChIKey | HPQLRFGZNVTZHW-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC=C1C(C(=O)O)(F)F |
Computed by PubChem (NCBI)