Products 197067-38-2

CAS 197067-38-2 is the registry number for 2-(2-Acetamidophenyl)-2,2-difluoroacetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(2-acetamidophenyl)-2,2-difluoroacetic acid (CAS 197067-38-2) is a chemical compound with the molecular formula C10H9F2NO3 and a molecular weight of 229.18 g/mol. IUPAC name: 2-(2-acetamidophenyl)-2,2-difluoroacetic acid. InChIKey: HPQLRFGZNVTZHW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9F2NO3
Molecular weight229.18 g/mol
IUPAC name2-(2-acetamidophenyl)-2,2-difluoroacetic acid
InChIKeyHPQLRFGZNVTZHW-UHFFFAOYSA-N
SMILESCC(=O)NC1=CC=CC=C1C(C(=O)O)(F)F

Computed by PubChem (NCBI)