Products 949444-66-0
CAS 949444-66-0 appears in our catalog under these names: 3-[(2,4-Difluorobenzoyl)amino]propanoic acid, 95%, 3-((2,4-Difluorophenyl)formamido)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-[(2,4-difluorobenzoyl)amino]propanoic acid (CAS 949444-66-0) is a chemical compound with the molecular formula C10H9F2NO3 and a molecular weight of 229.18 g/mol. IUPAC name: 3-[(2,4-difluorobenzoyl)amino]propanoic acid. InChIKey: SSYWEPJEANUKJE-UHFFFAOYSA-N.
| Molecular formula | C10H9F2NO3 |
|---|---|
| Molecular weight | 229.18 g/mol |
| IUPAC name | 3-[(2,4-difluorobenzoyl)amino]propanoic acid |
| InChIKey | SSYWEPJEANUKJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(=O)NCCC(=O)O |
Computed by PubChem (NCBI)