CAS 2766869-55-8 is the registry number for Ethyl 2,2-difluoro-2-(6-formylpyridin-2-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2,2-difluoro-2-(6-formyl-2-pyridinyl)acetate (CAS 2766869-55-8) is a chemical compound with the molecular formula C10H9F2NO3 and a molecular weight of 229.18 g/mol. IUPAC name: ethyl 2,2-difluoro-2-(6-formyl-2-pyridinyl)acetate. InChIKey: WRFUFYRUWSYLSZ-UHFFFAOYSA-N.
| Molecular formula | C10H9F2NO3 |
|---|---|
| Molecular weight | 229.18 g/mol |
| IUPAC name | ethyl 2,2-difluoro-2-(6-formyl-2-pyridinyl)acetate |
| InChIKey | WRFUFYRUWSYLSZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=CC(=N1)C=O)(F)F |
Computed by PubChem (NCBI)