Products 2766869-55-8

CAS 2766869-55-8 is the registry number for Ethyl 2,2-difluoro-2-(6-formylpyridin-2-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2,2-difluoro-2-(6-formyl-2-pyridinyl)acetate (CAS 2766869-55-8) is a chemical compound with the molecular formula C10H9F2NO3 and a molecular weight of 229.18 g/mol. IUPAC name: ethyl 2,2-difluoro-2-(6-formyl-2-pyridinyl)acetate. InChIKey: WRFUFYRUWSYLSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9F2NO3
Molecular weight229.18 g/mol
IUPAC nameethyl 2,2-difluoro-2-(6-formyl-2-pyridinyl)acetate
InChIKeyWRFUFYRUWSYLSZ-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=CC=CC(=N1)C=O)(F)F

Computed by PubChem (NCBI)