CAS 333441-80-8 appears in our catalog under these names: Ethyl 2-((2,4-difluorophenyl)amino)-2-oxoacetate, 95%, Ethyl 2–((2,4–difluorophenyl)amino)–2–oxoacetate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 100mg, 500mg.
Ethyl 2-(2,4-difluoroanilino)-2-oxoacetate (CAS 333441-80-8) is a chemical compound with the molecular formula C10H9F2NO3 and a molecular weight of 229.18 g/mol. IUPAC name: ethyl 2-(2,4-difluoroanilino)-2-oxoacetate. InChIKey: NZCVFTGULVCKAX-UHFFFAOYSA-N.
| Molecular formula | C10H9F2NO3 |
|---|---|
| Molecular weight | 229.18 g/mol |
| IUPAC name | ethyl 2-(2,4-difluoroanilino)-2-oxoacetate |
| InChIKey | NZCVFTGULVCKAX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)NC1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)