CAS 1153983-98-2 appears in our catalog under these names: 3-(3-Phenoxyphenyl)-1,2,4-thiadiazol-5-amine, 95%, 3-(3-Phenoxyphenyl)-1,2,4-thiadiazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(3-phenoxyphenyl)-1,2,4-thiadiazol-5-amine (CAS 1153983-98-2) is a chemical compound with the molecular formula C14H11N3OS and a molecular weight of 269.32 g/mol. IUPAC name: 3-(3-phenoxyphenyl)-1,2,4-thiadiazol-5-amine. InChIKey: ZAIUMGPYWKFFGO-UHFFFAOYSA-N.
| Molecular formula | C14H11N3OS |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | 3-(3-phenoxyphenyl)-1,2,4-thiadiazol-5-amine |
| InChIKey | ZAIUMGPYWKFFGO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C3=NSC(=N3)N |
Computed by PubChem (NCBI)