CAS 39072-28-1 appears in our catalog under these names: 2-Thiophen-2-yl-quinoline-4-carboxylic acid hydrazide, 95%, 2-(Thiophen-2-yl)quinoline-4-carbohydrazide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-thiophen-2-ylquinoline-4-carbohydrazide (CAS 39072-28-1) is a chemical compound with the molecular formula C14H11N3OS and a molecular weight of 269.32 g/mol. IUPAC name: 2-thiophen-2-ylquinoline-4-carbohydrazide. InChIKey: RRFXBVGSSZEUCZ-UHFFFAOYSA-N.
| Molecular formula | C14H11N3OS |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | 2-thiophen-2-ylquinoline-4-carbohydrazide |
| InChIKey | RRFXBVGSSZEUCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CC=CS3)C(=O)NN |
Computed by PubChem (NCBI)