CAS 383130-76-5 appears in our catalog under these names: 5-(3-Phenoxy-phenyl)-[1,3,4]thiadiazol-2-ylamine, 98%, 5-(3-Phenoxyphenyl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g.
5-(3-phenoxyphenyl)-1,3,4-thiadiazol-2-amine (CAS 383130-76-5) is a chemical compound with the molecular formula C14H11N3OS and a molecular weight of 269.32 g/mol. IUPAC name: 5-(3-phenoxyphenyl)-1,3,4-thiadiazol-2-amine. InChIKey: VBDYSFDCYGGHBA-UHFFFAOYSA-N.
| Molecular formula | C14H11N3OS |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | 5-(3-phenoxyphenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | VBDYSFDCYGGHBA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C3=NN=C(S3)N |
Computed by PubChem (NCBI)