CAS 1421263-79-7 is the registry number for 2-(5-Methyl-2-(pyrazin-2-yl)thiazol-4-yl)phenol, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-(5-methyl-2-pyrazin-2-yl-1,3-thiazol-4-yl)phenol (CAS 1421263-79-7) is a chemical compound with the molecular formula C14H11N3OS and a molecular weight of 269.32 g/mol. IUPAC name: 2-(5-methyl-2-pyrazin-2-yl-1,3-thiazol-4-yl)phenol. InChIKey: KZULLDYWHHCHNZ-UHFFFAOYSA-N.
| Molecular formula | C14H11N3OS |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | 2-(5-methyl-2-pyrazin-2-yl-1,3-thiazol-4-yl)phenol |
| InChIKey | KZULLDYWHHCHNZ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)C2=NC=CN=C2)C3=CC=CC=C3O |
Computed by PubChem (NCBI)