CAS 383130-70-9 is the registry number for 5-(2-Phenoxyphenyl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-phenoxyphenyl)-1,3,4-thiadiazol-2-amine (CAS 383130-70-9) is a chemical compound with the molecular formula C14H11N3OS and a molecular weight of 269.32 g/mol. IUPAC name: 5-(2-phenoxyphenyl)-1,3,4-thiadiazol-2-amine. InChIKey: VHHYILSEDLINOL-UHFFFAOYSA-N.
| Molecular formula | C14H11N3OS |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | 5-(2-phenoxyphenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | VHHYILSEDLINOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2C3=NN=C(S3)N |
Computed by PubChem (NCBI)