CAS 855715-38-7 is the registry number for 3-(5-Methylpyridin-2-yl)-2-sulfanyl-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
3-(5-methyl-2-pyridinyl)-2-sulfanylidene-1H-quinazolin-4-one (CAS 855715-38-7) is a chemical compound with the molecular formula C14H11N3OS and a molecular weight of 269.32 g/mol. IUPAC name: 3-(5-methyl-2-pyridinyl)-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: CKQWJHOXJDMCGC-UHFFFAOYSA-N.
| Molecular formula | C14H11N3OS |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | 3-(5-methyl-2-pyridinyl)-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | CKQWJHOXJDMCGC-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C=C1)N2C(=O)C3=CC=CC=C3NC2=S |
Computed by PubChem (NCBI)