Products 1154914-46-1
CAS 1154914-46-1 is the registry number for 7-Chloro-8-nitro-3,4-dihydro-2H-benzo[b][1,4]dioxepine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-chloro-8-nitro-3,4-dihydro-2H-1,5-benzodioxepine (CAS 1154914-46-1) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: 7-chloro-8-nitro-3,4-dihydro-2H-1,5-benzodioxepine. InChIKey: ADESRFNLRNRBPG-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | 7-chloro-8-nitro-3,4-dihydro-2H-1,5-benzodioxepine |
| InChIKey | ADESRFNLRNRBPG-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C(=C2)[N+](=O)[O-])Cl)OC1 |
Computed by PubChem (NCBI)