Products 115545-59-0
CAS 115545-59-0 is the registry number for 1-Adamantylaspartate. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-4-(1-adamantyloxy)-2-amino-4-oxobutanoic acid (CAS 115545-59-0) is a chemical compound with the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. IUPAC name: (2S)-4-(1-adamantyloxy)-2-amino-4-oxobutanoic acid. InChIKey: JWPBQLVAJXYMGD-RLFZITJJSA-N.
| Molecular formula | C14H21NO4 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | (2S)-4-(1-adamantyloxy)-2-amino-4-oxobutanoic acid |
| InChIKey | JWPBQLVAJXYMGD-RLFZITJJSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)OC(=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)