CAS 1156429-26-3 is the registry number for Benzo[d][1,3]dioxol-5-yl(2-(hydroxymethyl)piperidin-1-yl)methanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1,3-benzodioxol-5-yl-[2-(hydroxymethyl)piperidin-1-yl]methanone (CAS 1156429-26-3) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: 1,3-benzodioxol-5-yl-[2-(hydroxymethyl)piperidin-1-yl]methanone. InChIKey: DPXVPFXAQQSMND-UHFFFAOYSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 1,3-benzodioxol-5-yl-[2-(hydroxymethyl)piperidin-1-yl]methanone |
| InChIKey | DPXVPFXAQQSMND-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)CO)C(=O)C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)