CAS 115666-29-0 is the registry number for 4,6-Dibromo-1H-indole-3-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dibromo-1H-indole-3-carbaldehyde (CAS 115666-29-0) is a chemical compound with the molecular formula C9H5Br2NO and a molecular weight of 302.95 g/mol. IUPAC name: 4,6-dibromo-1H-indole-3-carbaldehyde. InChIKey: WXSICAIDSPWKLJ-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2NO |
|---|---|
| Molecular weight | 302.95 g/mol |
| IUPAC name | 4,6-dibromo-1H-indole-3-carbaldehyde |
| InChIKey | WXSICAIDSPWKLJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC=C2C=O)Br)Br |
Computed by PubChem (NCBI)