Products 2364585-15-7
CAS 2364585-15-7 appears in our catalog under these names: 5-(2,6-Dibromophenyl)oxazole, 95%, 5-(2,6-dibromophenyl)oxazole, ≥95%, ≥95%, 5-(2,6-Dibromophenyl)oxazole. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
5-(2,6-dibromophenyl)-1,3-oxazole (CAS 2364585-15-7) is a chemical compound with the molecular formula C9H5Br2NO and a molecular weight of 302.95 g/mol. IUPAC name: 5-(2,6-dibromophenyl)-1,3-oxazole. InChIKey: ZXPAFSHLLSKMOD-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2NO |
|---|---|
| Molecular weight | 302.95 g/mol |
| IUPAC name | 5-(2,6-dibromophenyl)-1,3-oxazole |
| InChIKey | ZXPAFSHLLSKMOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C2=CN=CO2)Br |
Computed by PubChem (NCBI)