CAS 173282-29-6 appears in our catalog under these names: 3,6-Dibromo-1H-quinolin-2-one, 95%, 3,6-Dibromoquinolin-2(1H)-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3,6-dibromo-1H-quinolin-2-one (CAS 173282-29-6) is a chemical compound with the molecular formula C9H5Br2NO and a molecular weight of 302.95 g/mol. IUPAC name: 3,6-dibromo-1H-quinolin-2-one. InChIKey: ANHQKHFDCMEFKD-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2NO |
|---|---|
| Molecular weight | 302.95 g/mol |
| IUPAC name | 3,6-dibromo-1H-quinolin-2-one |
| InChIKey | ANHQKHFDCMEFKD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C=C(C(=O)N2)Br |
Computed by PubChem (NCBI)