CAS 1203579-53-6 appears in our catalog under these names: 3,7-Dibromo-4-hydroxyquinoline, 95%, 3,7-Dibromoquinolin-4-ol, 95+%, 3,7–Dibromo–4–hydroxyquinoline, 3,7-Dibromo-4-hydroxyquinoline, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
3,7-dibromo-1H-quinolin-4-one (CAS 1203579-53-6) is a chemical compound with the molecular formula C9H5Br2NO and a molecular weight of 302.95 g/mol. IUPAC name: 3,7-dibromo-1H-quinolin-4-one. InChIKey: FCRKTWYWSKVPGU-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2NO |
|---|---|
| Molecular weight | 302.95 g/mol |
| IUPAC name | 3,7-dibromo-1H-quinolin-4-one |
| InChIKey | FCRKTWYWSKVPGU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC=C(C2=O)Br |
Computed by PubChem (NCBI)