CAS 1638219-70-1 is the registry number for 3-Bromo-5-(4-bromophenyl)isoxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5-(4-bromophenyl)-1,2-oxazole (CAS 1638219-70-1) is a chemical compound with the molecular formula C9H5Br2NO and a molecular weight of 302.95 g/mol. IUPAC name: 3-bromo-5-(4-bromophenyl)-1,2-oxazole. InChIKey: RODSZNPONYMERD-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2NO |
|---|---|
| Molecular weight | 302.95 g/mol |
| IUPAC name | 3-bromo-5-(4-bromophenyl)-1,2-oxazole |
| InChIKey | RODSZNPONYMERD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NO2)Br)Br |
Computed by PubChem (NCBI)