CAS 161837-27-0 is the registry number for 3,6-Dibromo-1h-quinolin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3,6-dibromo-1H-quinolin-4-one (CAS 161837-27-0) is a chemical compound with the molecular formula C9H5Br2NO and a molecular weight of 302.95 g/mol. IUPAC name: 3,6-dibromo-1H-quinolin-4-one. InChIKey: OMKUVZZMSAFTLL-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2NO |
|---|---|
| Molecular weight | 302.95 g/mol |
| IUPAC name | 3,6-dibromo-1H-quinolin-4-one |
| InChIKey | OMKUVZZMSAFTLL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)C(=CN2)Br |
Computed by PubChem (NCBI)