CAS 1156940-88-3 appears in our catalog under these names: Ethyl 7-nitro-2H-1,3-benzodioxole-5-carboxylate, 95%, Ethyl 7-nitro-1,3-dioxaindane-5-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Ethyl 7-nitro-1,3-benzodioxole-5-carboxylate (CAS 1156940-88-3) is a chemical compound with the molecular formula C10H9NO6 and a molecular weight of 239.18 g/mol. IUPAC name: ethyl 7-nitro-1,3-benzodioxole-5-carboxylate. InChIKey: FHJSVGYPVQYJIV-UHFFFAOYSA-N.
| Molecular formula | C10H9NO6 |
|---|---|
| Molecular weight | 239.18 g/mol |
| IUPAC name | ethyl 7-nitro-1,3-benzodioxole-5-carboxylate |
| InChIKey | FHJSVGYPVQYJIV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C2C(=C1)OCO2)[N+](=O)[O-] |
Computed by PubChem (NCBI)