Products 1157317-26-4

CAS 1157317-26-4 is the registry number for 3-((2-Methoxyethoxy)methyl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(2-methoxyethoxymethyl)benzenesulfonyl chloride (CAS 1157317-26-4) is a chemical compound with the molecular formula C10H13ClO4S and a molecular weight of 264.73 g/mol. IUPAC name: 3-(2-methoxyethoxymethyl)benzenesulfonyl chloride. InChIKey: IMVJCTUVFUCMAX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13ClO4S
Molecular weight264.73 g/mol
IUPAC name3-(2-methoxyethoxymethyl)benzenesulfonyl chloride
InChIKeyIMVJCTUVFUCMAX-UHFFFAOYSA-N
SMILESCOCCOCC1=CC(=CC=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)