Products 2407427-00-1

CAS 2407427-00-1 is the registry number for 3-Ethyl-2,6-dimethoxybenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-ethyl-2,6-dimethoxybenzenesulfonyl chloride (CAS 2407427-00-1) is a chemical compound with the molecular formula C10H13ClO4S and a molecular weight of 264.73 g/mol. IUPAC name: 3-ethyl-2,6-dimethoxybenzenesulfonyl chloride. InChIKey: ONEIGOGVJBKOGV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13ClO4S
Molecular weight264.73 g/mol
IUPAC name3-ethyl-2,6-dimethoxybenzenesulfonyl chloride
InChIKeyONEIGOGVJBKOGV-UHFFFAOYSA-N
SMILESCCC1=C(C(=C(C=C1)OC)S(=O)(=O)Cl)OC

Computed by PubChem (NCBI)