CAS 2407427-00-1 is the registry number for 3-Ethyl-2,6-dimethoxybenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-ethyl-2,6-dimethoxybenzenesulfonyl chloride (CAS 2407427-00-1) is a chemical compound with the molecular formula C10H13ClO4S and a molecular weight of 264.73 g/mol. IUPAC name: 3-ethyl-2,6-dimethoxybenzenesulfonyl chloride. InChIKey: ONEIGOGVJBKOGV-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO4S |
|---|---|
| Molecular weight | 264.73 g/mol |
| IUPAC name | 3-ethyl-2,6-dimethoxybenzenesulfonyl chloride |
| InChIKey | ONEIGOGVJBKOGV-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(C=C1)OC)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)