Products 69129-46-0
CAS 69129-46-0 appears in our catalog under these names: 4-(2-Methoxyethoxy)-3-methylbenzene-1-sulfonyl chloride, 4-(2-Methoxyethoxy)-3-methylbenzene-1-sulfonyl chloride 95+%, 4-(2-Methoxyethoxy)-3-methylbenzene-1-sulfonyl chloride, 95+%, 95+%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 2,5g, 1g, 5g, 10g, 25g.
4-(2-methoxyethoxy)-3-methylbenzenesulfonyl chloride (CAS 69129-46-0) is a chemical compound with the molecular formula C10H13ClO4S and a molecular weight of 264.73 g/mol. IUPAC name: 4-(2-methoxyethoxy)-3-methylbenzenesulfonyl chloride. InChIKey: CYUYJLMTRQASDR-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO4S |
|---|---|
| Molecular weight | 264.73 g/mol |
| IUPAC name | 4-(2-methoxyethoxy)-3-methylbenzenesulfonyl chloride |
| InChIKey | CYUYJLMTRQASDR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)Cl)OCCOC |
Computed by PubChem (NCBI)