CAS 82594-19-2 is the registry number for Camphorquinone-10-sulfonyl Chloride. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 100mg.
(7,7-dimethyl-2,3-dioxo-1-bicyclo[2.2.1]heptanyl)methanesulfonyl chloride (CAS 82594-19-2) is a chemical compound with the molecular formula C10H13ClO4S and a molecular weight of 264.73 g/mol. IUPAC name: (7,7-dimethyl-2,3-dioxo-1-bicyclo[2.2.1]heptanyl)methanesulfonyl chloride. InChIKey: MXMGFUNWQUEXIL-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO4S |
|---|---|
| Molecular weight | 264.73 g/mol |
| IUPAC name | (7,7-dimethyl-2,3-dioxo-1-bicyclo[2.2.1]heptanyl)methanesulfonyl chloride |
| InChIKey | MXMGFUNWQUEXIL-UHFFFAOYSA-N |
| SMILES | CC1(C2CCC1(C(=O)C2=O)CS(=O)(=O)Cl)C |
Computed by PubChem (NCBI)