Products 99188-17-7

CAS 99188-17-7 is the registry number for 3,4-Diethoxybenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

3,4-diethoxybenzenesulfonyl chloride (CAS 99188-17-7) is a chemical compound with the molecular formula C10H13ClO4S and a molecular weight of 264.73 g/mol. IUPAC name: 3,4-diethoxybenzenesulfonyl chloride. InChIKey: NWZSKQICFWXUHC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13ClO4S
Molecular weight264.73 g/mol
IUPAC name3,4-diethoxybenzenesulfonyl chloride
InChIKeyNWZSKQICFWXUHC-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1)S(=O)(=O)Cl)OCC

Computed by PubChem (NCBI)