CAS 99188-17-7 is the registry number for 3,4-Diethoxybenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3,4-diethoxybenzenesulfonyl chloride (CAS 99188-17-7) is a chemical compound with the molecular formula C10H13ClO4S and a molecular weight of 264.73 g/mol. IUPAC name: 3,4-diethoxybenzenesulfonyl chloride. InChIKey: NWZSKQICFWXUHC-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO4S |
|---|---|
| Molecular weight | 264.73 g/mol |
| IUPAC name | 3,4-diethoxybenzenesulfonyl chloride |
| InChIKey | NWZSKQICFWXUHC-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)S(=O)(=O)Cl)OCC |
Computed by PubChem (NCBI)