Products 1521992-49-3

CAS 1521992-49-3 is the registry number for 3-(3-Methoxypropoxy)benzene-1-sulfonyl chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

3-(3-methoxypropoxy)benzenesulfonyl chloride (CAS 1521992-49-3) is a chemical compound with the molecular formula C10H13ClO4S and a molecular weight of 264.73 g/mol. IUPAC name: 3-(3-methoxypropoxy)benzenesulfonyl chloride. InChIKey: RZQWBHXXTLMXJR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13ClO4S
Molecular weight264.73 g/mol
IUPAC name3-(3-methoxypropoxy)benzenesulfonyl chloride
InChIKeyRZQWBHXXTLMXJR-UHFFFAOYSA-N
SMILESCOCCCOC1=CC(=CC=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)