CAS 1157825-57-4 appears in our catalog under these names: 4-(2-Oxocyclohexyl)-1λâ¶-thiomorpholine-1,1-dione, 2-(1,1-Dioxidothiomorpholino)cyclohexan-1-one, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-(1,1-dioxo-1,4-thiazinan-4-yl)cyclohexan-1-one (CAS 1157825-57-4) is a chemical compound with the molecular formula C10H17NO3S and a molecular weight of 231.31 g/mol. IUPAC name: 2-(1,1-dioxo-1,4-thiazinan-4-yl)cyclohexan-1-one. InChIKey: ZMKBECGEGSGOQC-UHFFFAOYSA-N.
| Molecular formula | C10H17NO3S |
|---|---|
| Molecular weight | 231.31 g/mol |
| IUPAC name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)cyclohexan-1-one |
| InChIKey | ZMKBECGEGSGOQC-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C(C1)N2CCS(=O)(=O)CC2 |
Computed by PubChem (NCBI)